![](../images/chemdb_main_product.jpg) |
![](../images/title_product_content.gif) |
|
|
|
Forchlorfenuron |
![](../images/col_chem_composition.gif) |
N-(2-chloro-4-pyridinyl)-N'-phenylurea ; KT-30 |
![](../images/col_cas.gif) |
68157-60-8 |
![](../images/col_uses.gif) |
Plant growth regulator with cytokinin activity. The bioavailability of KT-30 is 10-100 times of that of 6BA. It is widely used in agriculture, horticulture and fruit. It can promote cell division and expansion, enlarge fruit, increase crop yield, etc. |
![](../images/col_property.gif) |
Molecular Formula: C12H10ClN3O Molecular Weight: 247.68 Appearance: White crystals Melting Point: 171-173¡ÆC
|
Industrial field |
agrochemical, biocide, fungicide, pharmaceutical |
|
|
![](../images/product_title_com.gif) |
|
|
|
![](../images/box_com_top2.gif) |
There are no existing companies to distribute selected chemical product |
|
![](../images/box_com_bottom.gif) |
|
|
|