 |
 |
|
|
|
| Griseofulvin |
 |
| 7-chloro-2',4,6-trimethoxy-6'-methyl-3H |
 |
| 126-07-8 |
 |
Usage: Can inhibit fungal mitosis, the mitotic spindle structure fracture, termination of cell division. This product is deposited in the skin, hair keratin precursor cells, can induce keratin resistance against fungal invasion when the infection of keratin after falling off, replaced by healthy tissue. On Epidermophyton, Microsporum and Trichophyton skin caused by fungal infection effectively, to other fungal infections including Candida and bacterial null
|
 |
Assay:99%min Package: 25kg / drum Appearance: White or white powder odorless, slightly bitter taste¡¡ CAS#:126-07-8 No. EINECS: 204-767-4 MF:CH17ClO6 InChI:InChI=1/C17H19ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h7-8,12H,5-6H2,1-4H3/t8-,12?,17+/m1/s1 MW: ?352.8 ¡¡¡¡ melting point: 218¢¦224¡É Boiling point: 527.9¡ÆC at 760 mmHg
|
| Industrial field |
pharmaceutical |
|
|
 |
|
|
|
|
|
 |
| There are no existing companies to distribute selected chemical product |
|
 |
|
|
|