 |
 |
|
|
|
Biotin |
 |
Vitamin H |
 |
58-85-5 |
 |
Usage: Mainly used for biotin deficiency, can also be used for seborrheic dermatitis and infant and urinary erythroderma, atrophic glossitis, hypersensitivity, muscle aches, fatigue, anorexia and mild anemia
|
 |
Assay: 99% Package: 25kg / drum Appearance: Colorless needle-like crystals¡¡ CAS#:58-85-5 No. EINECS: 200-399-3 MF: C10H16N2O3S InChI:InChI=1/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/p-1/t6-,7-,9+/m0/s1 MW: 244.3032 ¡¡¡¡ melting point: 232-233¡É
|
Industrial field |
pharmaceutical |
|
|
 |
|
|
|
 |
There are no existing companies to distribute selected chemical product |
|
 |
|
|
|