 |
 |
|
|
|
| Polysucrose Dormacoll (CAS No.:26873-85-8) |
 |
| Polysucrose Dormacoll (CAS No.:26873-85-8) |
 |
| pharmaceutical intermediate, mainly used for separation of a variety of cells, including blood cells, fibroblasts, tumor cells, rat liver cells |
 |
Polysucrose Dormacoll (CAS No.:26873-85-8)
CAS Number:26873-85-8
Formula:(C12H22O11)n.(C3H5ClO)n
Synonyms: Ficoll 400
See R-D-Glucopyranoside,a-D-fructofuranosyl,polymers,polymer with (chloromethyl)oxirane
Dormacoll
Assay:99%
Appearance:white powder
Packing: 25kg/drum
Application: pharmaceutical intermediate, mainly used for separation of a variety of cells, including blood cells, fibroblasts, tumor cells, rat liver cells |
| Industrial field |
pharmaceutical |
|
|
 |
|
|
|
|
|
 |
| There are no existing companies to distribute selected chemical product |
|
 |
|
|
|
